C31H40ClNO5 — CID 58952577
tert-butyl (1R,3aR,6R,7S,7aS)-6-(2-chloro-4-methoxyphenyl)-7-(4-ethoxyphenyl)-3a-ethyl-1-methyl-3-oxo-1,4,5,6,7,7a-hexahydroisoindole-2-carboxylate (PubChem CID 58952577) has the molecular formula C31H40ClNO5 and a molecular weight of 542.12 g/mol. Its IUPAC name is tert-butyl (1R,3aR,6R,7S,7aS)-6-(2-chloro-4-methoxyphenyl)-7-(4-ethoxyphenyl)-3a-ethyl-1-methyl-3-oxo-1,4,5,6,7,7a-hexahydroisoindole-2-carboxylate.
| Compound Name | tert-butyl (1R,3aR,6R,7S,7aS)-6-(2-chloro-4-methoxyphenyl)-7-(4-ethoxyphenyl)-3a-ethyl-1-methyl-3-oxo-1,4,5,6,7,7a-hexahydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 58952577 |
| Molecular Formula | C31H40ClNO5 |
| Molecular Weight | 542.12 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | tert-butyl (1R,3aR,6R,7S,7aS)-6-(2-chloro-4-methoxyphenyl)-7-(4-ethoxyphenyl)-3a-ethyl-1-methyl-3-oxo-1,4,5,6,7,7a-hexahydroisoindole-2-carboxylate |
| SMILES | CCOc1ccc([C@@H]2[C@@H]3[C@@H](C)N(C(=O)OC(C)(C)C)C(=O)[C@]3(CC)CC[C@H]2c2ccc(OC)cc2Cl)cc1 |
| InChI | InChI=1S/C31H40ClNO5/c1-8-31-17-16-24(23-15-14-22(36-7)18-25(23)32)26(20-10-12-21(13-11-20)37-9-2)27(31)19(3)33(28(31)34)29(35)38-30(4,5)6/h10-15,18-19,24,26-27H,8-9,16-17H2,1-7H3/t19-,24+,26+,27+,31-/m1/s1 |
| InChIKey | ZTFCTZOKJWJXFM-CSGNAJLFSA-N |
| XLogP | 7.59 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.12 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |