C21H21Cl2NO3 — CID 25005385
5-(2-chloro-4-methoxyphenyl)-4-(4-chlorophenyl)-7a-hydroxy-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one (PubChem CID 25005385) has the molecular formula C21H21Cl2NO3 and a molecular weight of 406.31 g/mol. Its IUPAC name is 5-(2-chloro-4-methoxyphenyl)-4-(4-chlorophenyl)-7a-hydroxy-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one.
| Compound Name | 5-(2-chloro-4-methoxyphenyl)-4-(4-chlorophenyl)-7a-hydroxy-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one |
|---|---|
| PubChem CID | 25005385 |
| Molecular Formula | C21H21Cl2NO3 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 5-(2-chloro-4-methoxyphenyl)-4-(4-chlorophenyl)-7a-hydroxy-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one |
| SMILES | COc1ccc(C2CCC3(O)C(=O)NCC3C2c2ccc(Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C21H21Cl2NO3/c1-27-14-6-7-15(18(23)10-14)16-8-9-21(26)17(11-24-20(21)25)19(16)12-2-4-13(22)5-3-12/h2-7,10,16-17,19,26H,8-9,11H2,1H3,(H,24,25) |
| InChIKey | BKNJRPROBHULSM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |