C22H20Cl2N2O — CID 58952174
4-[(3aR,4R,5S,7aS)-4-(4-chlorophenyl)-7a-methyl-1-oxo-3,3a,4,5,6,7-hexahydro-2H-isoindol-5-yl]-3-chlorobenzonitrile (PubChem CID 58952174) has the molecular formula C22H20Cl2N2O and a molecular weight of 399.32 g/mol. Its IUPAC name is 4-[(3aR,4R,5S,7aS)-4-(4-chlorophenyl)-7a-methyl-1-oxo-3,3a,4,5,6,7-hexahydro-2H-isoindol-5-yl]-3-chlorobenzonitrile.
| Compound Name | 4-[(3aR,4R,5S,7aS)-4-(4-chlorophenyl)-7a-methyl-1-oxo-3,3a,4,5,6,7-hexahydro-2H-isoindol-5-yl]-3-chlorobenzonitrile |
|---|---|
| PubChem CID | 58952174 |
| Molecular Formula | C22H20Cl2N2O |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 4-[(3aR,4R,5S,7aS)-4-(4-chlorophenyl)-7a-methyl-1-oxo-3,3a,4,5,6,7-hexahydro-2H-isoindol-5-yl]-3-chlorobenzonitrile |
| SMILES | C[C@]12CC[C@H](c3ccc(C#N)cc3Cl)[C@@H](c3ccc(Cl)cc3)[C@H]1CNC2=O |
| InChI | InChI=1S/C22H20Cl2N2O/c1-22-9-8-17(16-7-2-13(11-25)10-19(16)24)20(18(22)12-26-21(22)27)14-3-5-15(23)6-4-14/h2-7,10,17-18,20H,8-9,12H2,1H3,(H,26,27)/t17-,18-,20-,22+/m1/s1 |
| InChIKey | KIQDRMJBIVUBEX-DBQGFPOUSA-N |
| XLogP | 5.28 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |