C22H20ClIN2O — CID 89343960
4-[(3aS,4S,5R,7aR)-5-[4-chloro-2-(iodomethyl)phenyl]-1-oxo-2,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]benzonitrile (PubChem CID 89343960) has the molecular formula C22H20ClIN2O and a molecular weight of 490.77 g/mol. Its IUPAC name is 4-[(3aS,4S,5R,7aR)-5-[4-chloro-2-(iodomethyl)phenyl]-1-oxo-2,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]benzonitrile.
| Compound Name | 4-[(3aS,4S,5R,7aR)-5-[4-chloro-2-(iodomethyl)phenyl]-1-oxo-2,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 89343960 |
| Molecular Formula | C22H20ClIN2O |
| Molecular Weight | 490.77 g/mol |
| Exact Mass | 490.03 |
| IUPAC Name | 4-[(3aS,4S,5R,7aR)-5-[4-chloro-2-(iodomethyl)phenyl]-1-oxo-2,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]benzonitrile |
| SMILES | N#Cc1ccc([C@@H]2[C@@H]3CNC(=O)[C@@H]3CC[C@H]2c2ccc(Cl)cc2CI)cc1 |
| InChI | InChI=1S/C22H20ClIN2O/c23-16-5-6-17(15(9-16)10-24)18-7-8-19-20(12-26-22(19)27)21(18)14-3-1-13(11-25)2-4-14/h1-6,9,18-21H,7-8,10,12H2,(H,26,27)/t18-,19+,20+,21-/m0/s1 |
| InChIKey | MBCHTPHFJVEVOE-BQJUDKOJSA-N |
| XLogP | 5.17 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.77 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|