C21H18Cl3NO — CID 58952389
(3aS,4S,5S,7aR)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-6-methyl-2,3,3a,4,5,7a-hexahydroisoindol-1-one (PubChem CID 58952389) has the molecular formula C21H18Cl3NO and a molecular weight of 406.74 g/mol. Its IUPAC name is (3aS,4S,5S,7aR)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-6-methyl-2,3,3a,4,5,7a-hexahydroisoindol-1-one.
| Compound Name | (3aS,4S,5S,7aR)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-6-methyl-2,3,3a,4,5,7a-hexahydroisoindol-1-one |
|---|---|
| PubChem CID | 58952389 |
| Molecular Formula | C21H18Cl3NO |
| Molecular Weight | 406.74 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | (3aS,4S,5S,7aR)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-6-methyl-2,3,3a,4,5,7a-hexahydroisoindol-1-one |
| SMILES | CC1=C[C@H]2C(=O)NC[C@H]2[C@@H](c2ccc(Cl)cc2)[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H18Cl3NO/c1-11-8-16-17(10-25-21(16)26)20(12-2-4-13(22)5-3-12)19(11)15-7-6-14(23)9-18(15)24/h2-9,16-17,19-20H,10H2,1H3,(H,25,26)/t16-,17-,19+,20-/m1/s1 |
| InChIKey | MGVXQQRNGAMEKH-IZBJGVDFSA-N |
| XLogP | 5.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.74 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|