C21H19Cl2NO — CID 58952312
(3aS,4S,5S,7aS)-4,5-bis(4-chlorophenyl)-6-methyl-2,3,3a,4,5,7a-hexahydroisoindol-1-one (PubChem CID 58952312) has the molecular formula C21H19Cl2NO and a molecular weight of 372.30 g/mol. Its IUPAC name is (3aS,4S,5S,7aS)-4,5-bis(4-chlorophenyl)-6-methyl-2,3,3a,4,5,7a-hexahydroisoindol-1-one.
| Compound Name | (3aS,4S,5S,7aS)-4,5-bis(4-chlorophenyl)-6-methyl-2,3,3a,4,5,7a-hexahydroisoindol-1-one |
|---|---|
| PubChem CID | 58952312 |
| Molecular Formula | C21H19Cl2NO |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | (3aS,4S,5S,7aS)-4,5-bis(4-chlorophenyl)-6-methyl-2,3,3a,4,5,7a-hexahydroisoindol-1-one |
| SMILES | CC1=C[C@@H]2C(=O)NC[C@H]2[C@@H](c2ccc(Cl)cc2)[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19Cl2NO/c1-12-10-17-18(11-24-21(17)25)20(14-4-8-16(23)9-5-14)19(12)13-2-6-15(22)7-3-13/h2-10,17-20H,11H2,1H3,(H,24,25)/t17-,18+,19-,20+/m0/s1 |
| InChIKey | NVTGTDOQQCNVSY-ZGXWSNOMSA-N |
| XLogP | 5.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|