C21H18Cl2N2O — CID 58952163
4-[(3aS,4S,5R,7aR)-4-(4-chlorophenyl)-1-oxo-2,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-3-chlorobenzonitrile (PubChem CID 58952163) has the molecular formula C21H18Cl2N2O and a molecular weight of 385.29 g/mol. Its IUPAC name is 4-[(3aS,4S,5R,7aR)-4-(4-chlorophenyl)-1-oxo-2,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-3-chlorobenzonitrile.
| Compound Name | 4-[(3aS,4S,5R,7aR)-4-(4-chlorophenyl)-1-oxo-2,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-3-chlorobenzonitrile |
|---|---|
| PubChem CID | 58952163 |
| Molecular Formula | C21H18Cl2N2O |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 4-[(3aS,4S,5R,7aR)-4-(4-chlorophenyl)-1-oxo-2,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-3-chlorobenzonitrile |
| SMILES | N#Cc1ccc([C@@H]2CC[C@H]3C(=O)NC[C@H]3[C@H]2c2ccc(Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C21H18Cl2N2O/c22-14-4-2-13(3-5-14)20-16(7-8-17-18(20)11-25-21(17)26)15-6-1-12(10-24)9-19(15)23/h1-6,9,16-18,20H,7-8,11H2,(H,25,26)/t16-,17+,18+,20-/m0/s1 |
| InChIKey | BEIYVMIUDCMMJJ-XFKSJGNHSA-N |
| XLogP | 4.89 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |