C24H26Cl3NO — CID 58952292
(3R,3aS,4S,5R,7aR)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3-methyl-7a-propyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one (PubChem CID 58952292) has the molecular formula C24H26Cl3NO and a molecular weight of 450.84 g/mol. Its IUPAC name is (3R,3aS,4S,5R,7aR)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3-methyl-7a-propyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one.
| Compound Name | (3R,3aS,4S,5R,7aR)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3-methyl-7a-propyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one |
|---|---|
| PubChem CID | 58952292 |
| Molecular Formula | C24H26Cl3NO |
| Molecular Weight | 450.84 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | (3R,3aS,4S,5R,7aR)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3-methyl-7a-propyl-3,3a,4,5,6,7-hexahydro-2H-isoindol-1-one |
| SMILES | CCC[C@@]12CC[C@@H](c3ccc(Cl)cc3Cl)[C@H](c3ccc(Cl)cc3)[C@@H]1[C@@H](C)NC2=O |
| InChI | InChI=1S/C24H26Cl3NO/c1-3-11-24-12-10-19(18-9-8-17(26)13-20(18)27)21(15-4-6-16(25)7-5-15)22(24)14(2)28-23(24)29/h4-9,13-14,19,21-22H,3,10-12H2,1-2H3,(H,28,29)/t14-,19+,21+,22+,24-/m1/s1 |
| InChIKey | SJMUUUKTVLKJCV-YYYSFUPXSA-N |
| XLogP | 7.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.84 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |