C31H30Cl2N2O3 — CID 58952409
5-[4-[(3S,3aS,4S,5R,7aR)-4-(4-chlorophenyl)-7a-ethyl-3-(hydroxymethyl)-1-oxo-3,3a,4,5,6,7-hexahydro-2H-isoindol-5-yl]-3-chlorophenyl]-2-methoxybenzonitrile (PubChem CID 58952409) has the molecular formula C31H30Cl2N2O3 and a molecular weight of 549.50 g/mol. Its IUPAC name is 5-[4-[(3S,3aS,4S,5R,7aR)-4-(4-chlorophenyl)-7a-ethyl-3-(hydroxymethyl)-1-oxo-3,3a,4,5,6,7-hexahydro-2H-isoindol-5-yl]-3-chlorophenyl]-2-methoxybenzonitrile.
| Compound Name | 5-[4-[(3S,3aS,4S,5R,7aR)-4-(4-chlorophenyl)-7a-ethyl-3-(hydroxymethyl)-1-oxo-3,3a,4,5,6,7-hexahydro-2H-isoindol-5-yl]-3-chlorophenyl]-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 58952409 |
| Molecular Formula | C31H30Cl2N2O3 |
| Molecular Weight | 549.50 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | 5-[4-[(3S,3aS,4S,5R,7aR)-4-(4-chlorophenyl)-7a-ethyl-3-(hydroxymethyl)-1-oxo-3,3a,4,5,6,7-hexahydro-2H-isoindol-5-yl]-3-chlorophenyl]-2-methoxybenzonitrile |
| SMILES | CC[C@@]12CC[C@@H](c3ccc(-c4ccc(OC)c(C#N)c4)cc3Cl)[C@H](c3ccc(Cl)cc3)[C@@H]1[C@@H](CO)NC2=O |
| InChI | InChI=1S/C31H30Cl2N2O3/c1-3-31-13-12-24(28(18-4-8-22(32)9-5-18)29(31)26(17-36)35-30(31)37)23-10-6-20(15-25(23)33)19-7-11-27(38-2)21(14-19)16-34/h4-11,14-15,24,26,28-29,36H,3,12-13,17H2,1-2H3,(H,35,37)/t24-,26+,28-,29-,31+/m0/s1 |
| InChIKey | MECOCHMTWROWHU-BDWPYMAFSA-N |
| XLogP | 6.71 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.50 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |