C27H32Cl2N2O3 — CID 58952123
N-[2-[4-[(3R,3aS,4S,5R,7aR)-4-(4-chlorophenyl)-3,7a-dimethyl-1-oxo-3,3a,4,5,6,7-hexahydro-2H-isoindol-5-yl]-3-chlorophenoxy]ethyl]propanamide (PubChem CID 58952123) has the molecular formula C27H32Cl2N2O3 and a molecular weight of 503.47 g/mol. Its IUPAC name is N-[2-[4-[(3R,3aS,4S,5R,7aR)-4-(4-chlorophenyl)-3,7a-dimethyl-1-oxo-3,3a,4,5,6,7-hexahydro-2H-isoindol-5-yl]-3-chlorophenoxy]ethyl]propanamide.
| Compound Name | N-[2-[4-[(3R,3aS,4S,5R,7aR)-4-(4-chlorophenyl)-3,7a-dimethyl-1-oxo-3,3a,4,5,6,7-hexahydro-2H-isoindol-5-yl]-3-chlorophenoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 58952123 |
| Molecular Formula | C27H32Cl2N2O3 |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | N-[2-[4-[(3R,3aS,4S,5R,7aR)-4-(4-chlorophenyl)-3,7a-dimethyl-1-oxo-3,3a,4,5,6,7-hexahydro-2H-isoindol-5-yl]-3-chlorophenoxy]ethyl]propanamide |
| SMILES | CCC(=O)NCCOc1ccc([C@@H]2CC[C@@]3(C)C(=O)N[C@H](C)[C@H]3[C@H]2c2ccc(Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C27H32Cl2N2O3/c1-4-23(32)30-13-14-34-19-9-10-20(22(29)15-19)21-11-12-27(3)25(16(2)31-26(27)33)24(21)17-5-7-18(28)8-6-17/h5-10,15-16,21,24-25H,4,11-14H2,1-3H3,(H,30,32)(H,31,33)/t16-,21+,24+,25+,27-/m1/s1 |
| InChIKey | TVQOGBBAISSNDN-SKONIMJHSA-N |
| XLogP | 5.70 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|