C28H32Cl3NO4 — CID 91227809
tert-butyl (1S,3aS,6R,7S,7aR)-7-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-3a-ethoxy-1-methyl-3-oxo-1,4,5,6,7,7a-hexahydroisoindole-2-carboxylate (PubChem CID 91227809) has the molecular formula C28H32Cl3NO4 and a molecular weight of 552.93 g/mol. Its IUPAC name is tert-butyl (1S,3aS,6R,7S,7aR)-7-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-3a-ethoxy-1-methyl-3-oxo-1,4,5,6,7,7a-hexahydroisoindole-2-carboxylate.
| Compound Name | tert-butyl (1S,3aS,6R,7S,7aR)-7-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-3a-ethoxy-1-methyl-3-oxo-1,4,5,6,7,7a-hexahydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 91227809 |
| Molecular Formula | C28H32Cl3NO4 |
| Molecular Weight | 552.93 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | tert-butyl (1S,3aS,6R,7S,7aR)-7-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-3a-ethoxy-1-methyl-3-oxo-1,4,5,6,7,7a-hexahydroisoindole-2-carboxylate |
| SMILES | CCO[C@@]12CC[C@@H](c3ccc(Cl)cc3Cl)[C@H](c3ccc(Cl)cc3)[C@@H]1[C@H](C)N(C(=O)OC(C)(C)C)C2=O |
| InChI | InChI=1S/C28H32Cl3NO4/c1-6-35-28-14-13-21(20-12-11-19(30)15-22(20)31)23(17-7-9-18(29)10-8-17)24(28)16(2)32(25(28)33)26(34)36-27(3,4)5/h7-12,15-16,21,23-24H,6,13-14H2,1-5H3/t16-,21-,23-,24-,28-/m0/s1 |
| InChIKey | OMEKEFUUHMFGAS-BGJHJFKHSA-N |
| XLogP | 7.87 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.93 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |