C28H32Cl3N3O2 — CID 143512145
1-[[(3aR,6R,7S,7aS)-7-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-3-oxo-2,4,5,6,7,7a-hexahydro-1H-isoindol-3a-yl]methyl]-3-cyclohexylurea (PubChem CID 143512145) has the molecular formula C28H32Cl3N3O2 and a molecular weight of 548.94 g/mol. Its IUPAC name is 1-[[(3aR,6R,7S,7aS)-7-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-3-oxo-2,4,5,6,7,7a-hexahydro-1H-isoindol-3a-yl]methyl]-3-cyclohexylurea.
| Compound Name | 1-[[(3aR,6R,7S,7aS)-7-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-3-oxo-2,4,5,6,7,7a-hexahydro-1H-isoindol-3a-yl]methyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 143512145 |
| Molecular Formula | C28H32Cl3N3O2 |
| Molecular Weight | 548.94 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | 1-[[(3aR,6R,7S,7aS)-7-(4-chlorophenyl)-6-(2,4-dichlorophenyl)-3-oxo-2,4,5,6,7,7a-hexahydro-1H-isoindol-3a-yl]methyl]-3-cyclohexylurea |
| SMILES | O=C(NC[C@@]12CC[C@@H](c3ccc(Cl)cc3Cl)[C@H](c3ccc(Cl)cc3)[C@@H]1CNC2=O)NC1CCCCC1 |
| InChI | InChI=1S/C28H32Cl3N3O2/c29-18-8-6-17(7-9-18)25-22(21-11-10-19(30)14-24(21)31)12-13-28(23(25)15-32-26(28)35)16-33-27(36)34-20-4-2-1-3-5-20/h6-11,14,20,22-23,25H,1-5,12-13,15-16H2,(H,32,35)(H2,33,34,36)/t22-,23-,25-,28-/m0/s1 |
| InChIKey | AYGWSSLZXWXSNB-UNWVGDKSSA-N |
| XLogP | 6.67 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.94 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |