C24H26F3N3O2 — CID 58956435
4-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperazin-2-one (PubChem CID 58956435) has the molecular formula C24H26F3N3O2 and a molecular weight of 445.49 g/mol. Its IUPAC name is 4-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperazin-2-one.
| Compound Name | 4-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperazin-2-one |
|---|---|
| PubChem CID | 58956435 |
| Molecular Formula | C24H26F3N3O2 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 4-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperazin-2-one |
| SMILES | O=C1CN(C[C@H]2CC[C@@H]3[C@H](O2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccccc2)CCN1 |
| InChI | InChI=1S/C24H26F3N3O2/c25-24(26,27)16-6-9-20-19(12-16)23-18(22(29-20)15-4-2-1-3-5-15)8-7-17(32-23)13-30-11-10-28-21(31)14-30/h1-6,9,12,17-18,22-23,29H,7-8,10-11,13-14H2,(H,28,31)/t17-,18+,22+,23+/m1/s1 |
| InChIKey | CPBJBSNDSOTMNX-PNQHUFSXSA-N |
| XLogP | 4.14 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |