C28H35F3N4O2 — CID 58956663
2-[4-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperazin-1-yl]-N,N-dimethylacetamide (PubChem CID 58956663) has the molecular formula C28H35F3N4O2 and a molecular weight of 516.61 g/mol. Its IUPAC name is 2-[4-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperazin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperazin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 58956663 |
| Molecular Formula | C28H35F3N4O2 |
| Molecular Weight | 516.61 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 2-[4-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperazin-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1CCN(C[C@H]2CC[C@@H]3[C@H](O2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccccc2)CC1 |
| InChI | InChI=1S/C28H35F3N4O2/c1-33(2)25(36)18-35-14-12-34(13-15-35)17-21-9-10-22-26(19-6-4-3-5-7-19)32-24-11-8-20(28(29,30)31)16-23(24)27(22)37-21/h3-8,11,16,21-22,26-27,32H,9-10,12-15,17-18H2,1-2H3/t21-,22+,26+,27+/m1/s1 |
| InChIKey | OBHBNAHOZKQOIP-SEEQBUNISA-N |
| XLogP | 4.41 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.61 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |