C26H34N2O3 — CID 58965361
4-hexoxy-N-[1-oxo-1-(1,2,3,4-tetrahydronaphthalen-2-ylamino)propan-2-yl]benzamide (PubChem CID 58965361) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is 4-hexoxy-N-[1-oxo-1-(1,2,3,4-tetrahydronaphthalen-2-ylamino)propan-2-yl]benzamide.
| Compound Name | 4-hexoxy-N-[1-oxo-1-(1,2,3,4-tetrahydronaphthalen-2-ylamino)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 58965361 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 4-hexoxy-N-[1-oxo-1-(1,2,3,4-tetrahydronaphthalen-2-ylamino)propan-2-yl]benzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NC(C)C(=O)NC2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C26H34N2O3/c1-3-4-5-8-17-31-24-15-12-21(13-16-24)26(30)27-19(2)25(29)28-23-14-11-20-9-6-7-10-22(20)18-23/h6-7,9-10,12-13,15-16,19,23H,3-5,8,11,14,17-18H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | KESXWGDGUNIUTR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|