C48H52N3+ — CID 58965922
[(2E,5E)-2,5-bis[(2E)-2-(1-ethyl-3,3,5-trimethylindol-2-ylidene)ethylidene]-3-methylcyclopent-3-en-1-ylidene]-diphenylazanium (PubChem CID 58965922) has the molecular formula C48H52N3+ and a molecular weight of 670.97 g/mol. Its IUPAC name is [(2E,5E)-2,5-bis[(2E)-2-(1-ethyl-3,3,5-trimethylindol-2-ylidene)ethylidene]-3-methylcyclopent-3-en-1-ylidene]-diphenylazanium.
| Compound Name | [(2E,5E)-2,5-bis[(2E)-2-(1-ethyl-3,3,5-trimethylindol-2-ylidene)ethylidene]-3-methylcyclopent-3-en-1-ylidene]-diphenylazanium |
|---|---|
| PubChem CID | 58965922 |
| Molecular Formula | C48H52N3+ |
| Molecular Weight | 670.97 g/mol |
| Exact Mass | 670.42 |
| IUPAC Name | [(2E,5E)-2,5-bis[(2E)-2-(1-ethyl-3,3,5-trimethylindol-2-ylidene)ethylidene]-3-methylcyclopent-3-en-1-ylidene]-diphenylazanium |
| SMILES | CCN1/C(=C/C=C2\C=C(C)/C(=C\C=C3\N(CC)c4ccc(C)cc4C3(C)C)C2=[N+](c2ccccc2)c2ccccc2)C(C)(C)c2cc(C)ccc21 |
| InChI | InChI=1S/C48H52N3/c1-10-49-42-26-22-33(3)30-40(42)47(6,7)44(49)28-24-36-32-35(5)39(46(36)51(37-18-14-12-15-19-37)38-20-16-13-17-21-38)25-29-45-48(8,9)41-31-34(4)23-27-43(41)50(45)11-2/h12-32H,10-11H2,1-9H3/q+1 |
| InChIKey | CCLLEZVZZCLFAV-UHFFFAOYSA-N |
| XLogP | 11.80 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.97 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|