C16H14N6O3 — CID 58976386
4-[5-amino-3-(1,3-benzodioxol-5-ylamino)-1,2,4-triazol-1-yl]benzamide (PubChem CID 58976386) has the molecular formula C16H14N6O3 and a molecular weight of 338.33 g/mol. Its IUPAC name is 4-[5-amino-3-(1,3-benzodioxol-5-ylamino)-1,2,4-triazol-1-yl]benzamide.
| Compound Name | 4-[5-amino-3-(1,3-benzodioxol-5-ylamino)-1,2,4-triazol-1-yl]benzamide |
|---|---|
| PubChem CID | 58976386 |
| Molecular Formula | C16H14N6O3 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 4-[5-amino-3-(1,3-benzodioxol-5-ylamino)-1,2,4-triazol-1-yl]benzamide |
| SMILES | NC(=O)c1ccc(-n2nc(Nc3ccc4c(c3)OCO4)nc2N)cc1 |
| InChI | InChI=1S/C16H14N6O3/c17-14(23)9-1-4-11(5-2-9)22-15(18)20-16(21-22)19-10-3-6-12-13(7-10)25-8-24-12/h1-7H,8H2,(H2,17,23)(H3,18,19,20,21) |
| InChIKey | KDBSQIDYBQQAQM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |