C12H12ClF3N2O3S — CID 58979631
1-chloro-2-[1-methylsulfonyl-5-(trifluoromethyl)pyrrolo[3,2-b]pyridin-2-yl]propan-2-ol (PubChem CID 58979631) has the molecular formula C12H12ClF3N2O3S and a molecular weight of 356.75 g/mol. Its IUPAC name is 1-chloro-2-[1-methylsulfonyl-5-(trifluoromethyl)pyrrolo[3,2-b]pyridin-2-yl]propan-2-ol.
| Compound Name | 1-chloro-2-[1-methylsulfonyl-5-(trifluoromethyl)pyrrolo[3,2-b]pyridin-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 58979631 |
| Molecular Formula | C12H12ClF3N2O3S |
| Molecular Weight | 356.75 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 1-chloro-2-[1-methylsulfonyl-5-(trifluoromethyl)pyrrolo[3,2-b]pyridin-2-yl]propan-2-ol |
| SMILES | CC(O)(CCl)c1cc2nc(C(F)(F)F)ccc2n1S(C)(=O)=O |
| InChI | InChI=1S/C12H12ClF3N2O3S/c1-11(19,6-13)10-5-7-8(18(10)22(2,20)21)3-4-9(17-7)12(14,15)16/h3-5,19H,6H2,1-2H3 |
| InChIKey | IHMGAMWNXCCVEC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.75 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|