C32H35N3O11 — CID 58994252
5-[(5S)-5-amino-9-(1-aminoethylideneamino)-2-[[2-(hydroxymethoxy)-4-oxochromen-5-yl]oxymethyl]-4-oxononoxy]-4-oxochromene-2-carboxylic acid (PubChem CID 58994252) has the molecular formula C32H35N3O11 and a molecular weight of 637.64 g/mol. Its IUPAC name is 5-[(5S)-5-amino-9-(1-aminoethylideneamino)-2-[[2-(hydroxymethoxy)-4-oxochromen-5-yl]oxymethyl]-4-oxononoxy]-4-oxochromene-2-carboxylic acid.
| Compound Name | 5-[(5S)-5-amino-9-(1-aminoethylideneamino)-2-[[2-(hydroxymethoxy)-4-oxochromen-5-yl]oxymethyl]-4-oxononoxy]-4-oxochromene-2-carboxylic acid |
|---|---|
| PubChem CID | 58994252 |
| Molecular Formula | C32H35N3O11 |
| Molecular Weight | 637.64 g/mol |
| Exact Mass | 637.23 |
| IUPAC Name | 5-[(5S)-5-amino-9-(1-aminoethylideneamino)-2-[[2-(hydroxymethoxy)-4-oxochromen-5-yl]oxymethyl]-4-oxononoxy]-4-oxochromene-2-carboxylic acid |
| SMILES | C/C(N)=N\CCCC[C@H](N)C(=O)CC(COc1cccc2oc(OCO)cc(=O)c12)COc1cccc2oc(C(=O)O)cc(=O)c12 |
| InChI | InChI=1S/C32H35N3O11/c1-18(33)35-11-3-2-6-20(34)21(37)12-19(15-42-24-7-4-9-26-30(24)22(38)13-28(45-26)32(40)41)16-43-25-8-5-10-27-31(25)23(39)14-29(46-27)44-17-36/h4-5,7-10,13-14,19-20,36H,2-3,6,11-12,15-17,34H2,1H3,(H2,33,35)(H,40,41)/t19?,20-/m0/s1 |
| InChIKey | YBBHQCJQMGKMLB-ANYOKISRSA-N |
| XLogP | 2.83 |
| TPSA | 227.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.64 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|