C11H21N3S — CID 58997914
5-heptyl-1,4-dimethyl-1,2,4-triazol-4-ium-3-thiolate (PubChem CID 58997914) has the molecular formula C11H21N3S and a molecular weight of 227.38 g/mol. Its IUPAC name is 5-heptyl-1,4-dimethyl-1,2,4-triazol-4-ium-3-thiolate.
| Compound Name | 5-heptyl-1,4-dimethyl-1,2,4-triazol-4-ium-3-thiolate |
|---|---|
| PubChem CID | 58997914 |
| Molecular Formula | C11H21N3S |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 5-heptyl-1,4-dimethyl-1,2,4-triazol-4-ium-3-thiolate |
| SMILES | CCCCCCCc1n(C)nc([S-])[n+]1C |
| InChI | InChI=1S/C11H21N3S/c1-4-5-6-7-8-9-10-13(2)11(15)12-14(10)3/h4-9H2,1-3H3 |
| InChIKey | RJYROGOTAQMQPX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|