C21H16F3NO4 — CID 59003000
ethyl 2-benzyl-6,7,8-trifluoro-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraene-11-carboxylate (PubChem CID 59003000) has the molecular formula C21H16F3NO4 and a molecular weight of 403.36 g/mol. Its IUPAC name is ethyl 2-benzyl-6,7,8-trifluoro-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraene-11-carboxylate.
| Compound Name | ethyl 2-benzyl-6,7,8-trifluoro-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 59003000 |
| Molecular Formula | C21H16F3NO4 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | ethyl 2-benzyl-6,7,8-trifluoro-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraene-11-carboxylate |
| SMILES | CCOC(=O)c1cn2c3c(c(F)c(F)c(F)c3c1=O)OCC2Cc1ccccc1 |
| InChI | InChI=1S/C21H16F3NO4/c1-2-28-21(27)13-9-25-12(8-11-6-4-3-5-7-11)10-29-20-17(24)16(23)15(22)14(18(20)25)19(13)26/h3-7,9,12H,2,8,10H2,1H3 |
| InChIKey | JBVNSIFGZJCMOI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|