C25H30N8 — CID 59011460
3-N-[4-(1-isocyano-4-piperidin-1-ylcyclohexyl)phenyl]-1-pyridin-2-yl-1,2,4-triazole-3,5-diamine (PubChem CID 59011460) has the molecular formula C25H30N8 and a molecular weight of 442.57 g/mol. Its IUPAC name is 3-N-[4-(1-isocyano-4-piperidin-1-ylcyclohexyl)phenyl]-1-pyridin-2-yl-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[4-(1-isocyano-4-piperidin-1-ylcyclohexyl)phenyl]-1-pyridin-2-yl-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 59011460 |
| Molecular Formula | C25H30N8 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 3-N-[4-(1-isocyano-4-piperidin-1-ylcyclohexyl)phenyl]-1-pyridin-2-yl-1,2,4-triazole-3,5-diamine |
| SMILES | [C-]#[N+]C1(c2ccc(Nc3nc(N)n(-c4ccccn4)n3)cc2)CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C25H30N8/c1-27-25(14-12-21(13-15-25)32-17-5-2-6-18-32)19-8-10-20(11-9-19)29-24-30-23(26)33(31-24)22-7-3-4-16-28-22/h3-4,7-11,16,21H,2,5-6,12-15,17-18H2,(H3,26,29,30,31) |
| InChIKey | YSBOPRJWTCZBGQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|