C11H12BrNO2S2 — CID 59015272
tert-butyl N-(5-bromothieno[3,2-b]thiophen-2-yl)carbamate (PubChem CID 59015272) has the molecular formula C11H12BrNO2S2 and a molecular weight of 334.26 g/mol. Its IUPAC name is tert-butyl N-(5-bromothieno[3,2-b]thiophen-2-yl)carbamate.
| Compound Name | tert-butyl N-(5-bromothieno[3,2-b]thiophen-2-yl)carbamate |
|---|---|
| PubChem CID | 59015272 |
| Molecular Formula | C11H12BrNO2S2 |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 332.95 |
| IUPAC Name | tert-butyl N-(5-bromothieno[3,2-b]thiophen-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc2sc(Br)cc2s1 |
| InChI | InChI=1S/C11H12BrNO2S2/c1-11(2,3)15-10(14)13-9-5-7-6(17-9)4-8(12)16-7/h4-5H,1-3H3,(H,13,14) |
| InChIKey | XLHKHWNGQHGNRI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |