C16H4N6O2 — CID 59018892
7,8-diisocyano-5-oxido-10-oxophenazin-10-ium-2,3-dicarbonitrile (PubChem CID 59018892) has the molecular formula C16H4N6O2 and a molecular weight of 312.25 g/mol. Its IUPAC name is 7,8-diisocyano-5-oxido-10-oxophenazin-10-ium-2,3-dicarbonitrile.
| Compound Name | 7,8-diisocyano-5-oxido-10-oxophenazin-10-ium-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 59018892 |
| Molecular Formula | C16H4N6O2 |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 7,8-diisocyano-5-oxido-10-oxophenazin-10-ium-2,3-dicarbonitrile |
| SMILES | [C-]#[N+]c1cc2c(cc1[N+]#[C-])[n+](=O)c1cc(C#N)c(C#N)cc1n2[O-] |
| InChI | InChI=1S/C16H4N6O2/c1-19-11-5-15-16(6-12(11)20-2)22(24)14-4-10(8-18)9(7-17)3-13(14)21(15)23/h3-6H |
| InChIKey | HCNCMQXXZLBKGT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 107.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|