C23H28FN3O4 — CID 59021416
[4-(3-aminopropoxy)-2-fluorophenyl]-[6-(3-ethoxy-4-methoxyphenyl)-4,5-dihydro-3H-pyridazin-2-yl]methanone (PubChem CID 59021416) has the molecular formula C23H28FN3O4 and a molecular weight of 429.49 g/mol. Its IUPAC name is [4-(3-aminopropoxy)-2-fluorophenyl]-[6-(3-ethoxy-4-methoxyphenyl)-4,5-dihydro-3H-pyridazin-2-yl]methanone.
| Compound Name | [4-(3-aminopropoxy)-2-fluorophenyl]-[6-(3-ethoxy-4-methoxyphenyl)-4,5-dihydro-3H-pyridazin-2-yl]methanone |
|---|---|
| PubChem CID | 59021416 |
| Molecular Formula | C23H28FN3O4 |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | [4-(3-aminopropoxy)-2-fluorophenyl]-[6-(3-ethoxy-4-methoxyphenyl)-4,5-dihydro-3H-pyridazin-2-yl]methanone |
| SMILES | CCOc1cc(C2=NN(C(=O)c3ccc(OCCCN)cc3F)CCC2)ccc1OC |
| InChI | InChI=1S/C23H28FN3O4/c1-3-30-22-14-16(7-10-21(22)29-2)20-6-4-12-27(26-20)23(28)18-9-8-17(15-19(18)24)31-13-5-11-25/h7-10,14-15H,3-6,11-13,25H2,1-2H3 |
| InChIKey | ZIKHTGMZJSEHKK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|