C11H11F5O2 — CID 59024475
4,4,5,5,5-pentafluoro-2-phenoxypentan-1-ol (PubChem CID 59024475) has the molecular formula C11H11F5O2 and a molecular weight of 270.20 g/mol. Its IUPAC name is 4,4,5,5,5-pentafluoro-2-phenoxypentan-1-ol.
| Compound Name | 4,4,5,5,5-pentafluoro-2-phenoxypentan-1-ol |
|---|---|
| PubChem CID | 59024475 |
| Molecular Formula | C11H11F5O2 |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4,4,5,5,5-pentafluoro-2-phenoxypentan-1-ol |
| SMILES | OCC(CC(F)(F)C(F)(F)F)Oc1ccccc1 |
| InChI | InChI=1S/C11H11F5O2/c12-10(13,11(14,15)16)6-9(7-17)18-8-4-2-1-3-5-8/h1-5,9,17H,6-7H2 |
| InChIKey | HUQSXQIIEKIEFN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|