C24H17ClN4O2S2 — CID 59025880
2-(4-chlorophenyl)-3-(4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one (PubChem CID 59025880) has the molecular formula C24H17ClN4O2S2 and a molecular weight of 493.01 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one.
| Compound Name | 2-(4-chlorophenyl)-3-(4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one |
|---|---|
| PubChem CID | 59025880 |
| Molecular Formula | C24H17ClN4O2S2 |
| Molecular Weight | 493.01 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one |
| SMILES | Cc1nc(-c2cccs2)sc1C(=O)N1CCN2C(=O)c3ccncc3C21c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H17ClN4O2S2/c1-14-20(33-21(27-14)19-3-2-12-32-19)23(31)29-11-10-28-22(30)17-8-9-26-13-18(17)24(28,29)15-4-6-16(25)7-5-15/h2-9,12-13H,10-11H2,1H3 |
| InChIKey | RUSMLOMBGMHGKZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.01 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |