C25H18ClN5O2S — CID 59025924
2-(4-chlorophenyl)-3-(4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one (PubChem CID 59025924) has the molecular formula C25H18ClN5O2S and a molecular weight of 487.97 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one.
| Compound Name | 2-(4-chlorophenyl)-3-(4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one |
|---|---|
| PubChem CID | 59025924 |
| Molecular Formula | C25H18ClN5O2S |
| Molecular Weight | 487.97 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one |
| SMILES | Cc1nc(-c2cccnc2)sc1C(=O)N1CCN2C(=O)c3ccncc3C21c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H18ClN5O2S/c1-15-21(34-22(29-15)16-3-2-9-27-13-16)24(33)31-12-11-30-23(32)19-8-10-28-14-20(19)25(30,31)17-4-6-18(26)7-5-17/h2-10,13-14H,11-12H2,1H3 |
| InChIKey | BTVYPYDQHWDNIF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 79.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.97 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |