C20H24O5 — CID 59032086
(2S,3R,5S)-5-[hydroxy(phenyl)methoxy]-2-methyl-3-phenylmethoxyoxan-4-ol (PubChem CID 59032086) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (2S,3R,5S)-5-[hydroxy(phenyl)methoxy]-2-methyl-3-phenylmethoxyoxan-4-ol.
| Compound Name | (2S,3R,5S)-5-[hydroxy(phenyl)methoxy]-2-methyl-3-phenylmethoxyoxan-4-ol |
|---|---|
| PubChem CID | 59032086 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (2S,3R,5S)-5-[hydroxy(phenyl)methoxy]-2-methyl-3-phenylmethoxyoxan-4-ol |
| SMILES | C[C@@H]1OC[C@H](OC(O)c2ccccc2)C(O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C20H24O5/c1-14-19(24-12-15-8-4-2-5-9-15)18(21)17(13-23-14)25-20(22)16-10-6-3-7-11-16/h2-11,14,17-22H,12-13H2,1H3/t14-,17-,18?,19-,20?/m0/s1 |
| InChIKey | VKTVCGLHABDZDO-KKQICICFSA-N |
| XLogP | 2.43 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|