C32H34N2O2 — CID 59032448
2-[2-[(E)-[7-(diethylamino)-4-methylchromen-2-ylidene]methyl]-6-(2,4,6-trimethylphenyl)pyran-4-ylidene]propanenitrile (PubChem CID 59032448) has the molecular formula C32H34N2O2 and a molecular weight of 478.64 g/mol. Its IUPAC name is 2-[2-[(E)-[7-(diethylamino)-4-methylchromen-2-ylidene]methyl]-6-(2,4,6-trimethylphenyl)pyran-4-ylidene]propanenitrile.
| Compound Name | 2-[2-[(E)-[7-(diethylamino)-4-methylchromen-2-ylidene]methyl]-6-(2,4,6-trimethylphenyl)pyran-4-ylidene]propanenitrile |
|---|---|
| PubChem CID | 59032448 |
| Molecular Formula | C32H34N2O2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 2-[2-[(E)-[7-(diethylamino)-4-methylchromen-2-ylidene]methyl]-6-(2,4,6-trimethylphenyl)pyran-4-ylidene]propanenitrile |
| SMILES | CCN(CC)c1ccc2c(c1)O/C(=C/C1=CC(=C(C)C#N)C=C(c3c(C)cc(C)cc3C)O1)C=C2C |
| InChI | InChI=1S/C32H34N2O2/c1-8-34(9-2)26-10-11-29-21(4)14-27(35-30(29)17-26)18-28-15-25(24(7)19-33)16-31(36-28)32-22(5)12-20(3)13-23(32)6/h10-18H,8-9H2,1-7H3/b25-24?,27-18+ |
| InChIKey | VTFFGBBLCDAHGW-YOVOZYGCSA-N |
| XLogP | 7.93 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|