C26H21NO3 — CID 91006415
(2Z)-2-[2-methyl-6-[(4-methyl-7-phenoxychromen-2-ylidene)methyl]pyran-4-ylidene]propanenitrile (PubChem CID 91006415) has the molecular formula C26H21NO3 and a molecular weight of 395.46 g/mol. Its IUPAC name is (2Z)-2-[2-methyl-6-[(4-methyl-7-phenoxychromen-2-ylidene)methyl]pyran-4-ylidene]propanenitrile.
| Compound Name | (2Z)-2-[2-methyl-6-[(4-methyl-7-phenoxychromen-2-ylidene)methyl]pyran-4-ylidene]propanenitrile |
|---|---|
| PubChem CID | 91006415 |
| Molecular Formula | C26H21NO3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | (2Z)-2-[2-methyl-6-[(4-methyl-7-phenoxychromen-2-ylidene)methyl]pyran-4-ylidene]propanenitrile |
| SMILES | CC1=C/C(=C(\C)C#N)C=C(C=C2C=C(C)c3ccc(Oc4ccccc4)cc3O2)O1 |
| InChI | InChI=1S/C26H21NO3/c1-17-11-23(14-24-13-20(18(2)16-27)12-19(3)28-24)30-26-15-22(9-10-25(17)26)29-21-7-5-4-6-8-21/h4-15H,1-3H3/b20-18-,23-14? |
| InChIKey | YTMAPFWHTKORAR-ICKMXYFOSA-N |
| XLogP | 6.82 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|