C41H35NO4 — CID 72594718
2-[2-[[7-(diethylamino)-4-methylchromen-2-ylidene]methyl]-6-phenylpyran-4-ylidene]-1,3-diphenylpropane-1,3-dione (PubChem CID 72594718) has the molecular formula C41H35NO4 and a molecular weight of 605.73 g/mol. Its IUPAC name is 2-[2-[[7-(diethylamino)-4-methylchromen-2-ylidene]methyl]-6-phenylpyran-4-ylidene]-1,3-diphenylpropane-1,3-dione.
| Compound Name | 2-[2-[[7-(diethylamino)-4-methylchromen-2-ylidene]methyl]-6-phenylpyran-4-ylidene]-1,3-diphenylpropane-1,3-dione |
|---|---|
| PubChem CID | 72594718 |
| Molecular Formula | C41H35NO4 |
| Molecular Weight | 605.73 g/mol |
| Exact Mass | 605.26 |
| IUPAC Name | 2-[2-[[7-(diethylamino)-4-methylchromen-2-ylidene]methyl]-6-phenylpyran-4-ylidene]-1,3-diphenylpropane-1,3-dione |
| SMILES | CCN(CC)c1ccc2c(c1)OC(=CC1=CC(=C(C(=O)c3ccccc3)C(=O)c3ccccc3)C=C(c3ccccc3)O1)C=C2C |
| InChI | InChI=1S/C41H35NO4/c1-4-42(5-2)33-21-22-36-28(3)23-34(46-38(36)26-33)27-35-24-32(25-37(45-35)29-15-9-6-10-16-29)39(40(43)30-17-11-7-12-18-30)41(44)31-19-13-8-14-20-31/h6-27H,4-5H2,1-3H3 |
| InChIKey | NEUISMOYULQDAB-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.73 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|