C24H23N3OS — CID 72594727
2-[2-[[7-(diethylamino)-4-methylchromen-2-ylidene]methyl]-6-methylthiopyran-4-ylidene]propanedinitrile (PubChem CID 72594727) has the molecular formula C24H23N3OS and a molecular weight of 401.54 g/mol. Its IUPAC name is 2-[2-[[7-(diethylamino)-4-methylchromen-2-ylidene]methyl]-6-methylthiopyran-4-ylidene]propanedinitrile.
| Compound Name | 2-[2-[[7-(diethylamino)-4-methylchromen-2-ylidene]methyl]-6-methylthiopyran-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 72594727 |
| Molecular Formula | C24H23N3OS |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 2-[2-[[7-(diethylamino)-4-methylchromen-2-ylidene]methyl]-6-methylthiopyran-4-ylidene]propanedinitrile |
| SMILES | CCN(CC)c1ccc2c(c1)OC(=CC1=CC(=C(C#N)C#N)C=C(C)S1)C=C2C |
| InChI | InChI=1S/C24H23N3OS/c1-5-27(6-2)20-7-8-23-16(3)9-21(28-24(23)12-20)13-22-11-18(10-17(4)29-22)19(14-25)15-26/h7-13H,5-6H2,1-4H3 |
| InChIKey | JOODAUPARHYYBP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 60.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|