About 5-phenoxy-1,3-benzodioxole-2-thione
5-phenoxy-1,3-benzodioxole-2-thione (PubChem CID 86164143) has the molecular formula C13H8O3S
and a molecular weight of 244.27 g/mol. Its IUPAC name is 5-phenoxy-1,3-benzodioxole-2-thione.
Molecular Properties
| Compound Name | 5-phenoxy-1,3-benzodioxole-2-thione |
| PubChem CID | 86164143 |
| Molecular Formula | C13H8O3S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 5-phenoxy-1,3-benzodioxole-2-thione |
| SMILES | S=c1oc2ccc(Oc3ccccc3)cc2o1 |
| InChI | InChI=1S/C13H8O3S/c17-13-15-11-7-6-10(8-12(11)16-13)14-9-4-2-1-3-5-9/h1-8H |
| InChIKey | XBSZPZIRDUHIHD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 35.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-phenoxy-1,3-benzodioxole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenoxy-1,3-benzodioxole-2-thione?
The IUPAC name of 5-phenoxy-1,3-benzodioxole-2-thione (CID 86164143) is 5-phenoxy-1,3-benzodioxole-2-thione.
What is the SMILES notation for 5-phenoxy-1,3-benzodioxole-2-thione?
The canonical SMILES for 5-phenoxy-1,3-benzodioxole-2-thione is S=c1oc2ccc(Oc3ccccc3)cc2o1.
What is the InChIKey of 5-phenoxy-1,3-benzodioxole-2-thione?
The InChIKey is XBSZPZIRDUHIHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8O3S/c17-13-15-11-7-6-10(8-12(11)16-13)14-9-4-2-1-3-5-9/h1-8H.
What are the key properties of 5-phenoxy-1,3-benzodioxole-2-thione?
5-phenoxy-1,3-benzodioxole-2-thione has a molecular weight of 244.27 g/mol, XLogP of 4.55, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenoxy-1,3-benzodioxole-2-thione is sourced from PubChem (CID 86164143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).