C20H18Cl3NO5 — CID 59033475
(4S,5R)-4-phenyl-2-phenylmethoxy-5-(2,2,2-trichloroethoxymethoxy)-4,5-dihydro-1,3-oxazin-6-one (PubChem CID 59033475) has the molecular formula C20H18Cl3NO5 and a molecular weight of 458.73 g/mol. Its IUPAC name is (4S,5R)-4-phenyl-2-phenylmethoxy-5-(2,2,2-trichloroethoxymethoxy)-4,5-dihydro-1,3-oxazin-6-one.
| Compound Name | (4S,5R)-4-phenyl-2-phenylmethoxy-5-(2,2,2-trichloroethoxymethoxy)-4,5-dihydro-1,3-oxazin-6-one |
|---|---|
| PubChem CID | 59033475 |
| Molecular Formula | C20H18Cl3NO5 |
| Molecular Weight | 458.73 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | (4S,5R)-4-phenyl-2-phenylmethoxy-5-(2,2,2-trichloroethoxymethoxy)-4,5-dihydro-1,3-oxazin-6-one |
| SMILES | O=C1OC(OCc2ccccc2)=N[C@@H](c2ccccc2)[C@H]1OCOCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C20H18Cl3NO5/c21-20(22,23)12-26-13-28-17-16(15-9-5-2-6-10-15)24-19(29-18(17)25)27-11-14-7-3-1-4-8-14/h1-10,16-17H,11-13H2/t16-,17+/m0/s1 |
| InChIKey | UOBZNWLCASACFR-DLBZAZTESA-N |
| XLogP | 4.59 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.73 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|