C25H35N3O4S — CID 59036012
2-nitro-N-[8-(1,2,3,4-tetrahydronaphthalen-2-ylmethylamino)octyl]benzenesulfonamide (PubChem CID 59036012) has the molecular formula C25H35N3O4S and a molecular weight of 473.64 g/mol. Its IUPAC name is 2-nitro-N-[8-(1,2,3,4-tetrahydronaphthalen-2-ylmethylamino)octyl]benzenesulfonamide.
| Compound Name | 2-nitro-N-[8-(1,2,3,4-tetrahydronaphthalen-2-ylmethylamino)octyl]benzenesulfonamide |
|---|---|
| PubChem CID | 59036012 |
| Molecular Formula | C25H35N3O4S |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 2-nitro-N-[8-(1,2,3,4-tetrahydronaphthalen-2-ylmethylamino)octyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)NCCCCCCCCNCC1CCc2ccccc2C1 |
| InChI | InChI=1S/C25H35N3O4S/c29-28(30)24-13-7-8-14-25(24)33(31,32)27-18-10-4-2-1-3-9-17-26-20-21-15-16-22-11-5-6-12-23(22)19-21/h5-8,11-14,21,26-27H,1-4,9-10,15-20H2 |
| InChIKey | BOGROBLIEFUPST-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|