C15H26BN4O8S — CID 59036288
CID 59036288 (PubChem CID 59036288) has the molecular formula C15H26BN4O8S and a molecular weight of 435.28 g/mol.
| Compound Name | CID 59036288 |
|---|---|
| PubChem CID | 59036288 |
| Molecular Formula | C15H26BN4O8S |
| Molecular Weight | 435.28 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | — |
| SMILES | [H]/N=C(\C)O[C@@H]1OC(C)[C@H](O[C@@H]2OC(CO)[C@H](OS[B][3H])[C@H](O)C2N=[N+]=[N-])[C@H](C)C1O |
| InChI | InChI=1S/C15H26BN4O8S/c1-5-10(22)15(25-7(3)17)24-6(2)12(5)27-14-9(19-20-18)11(23)13(28-29-16)8(4-21)26-14/h5-6,8-17,21-23H,4H2,1-3H3/b17-7+/t5-,6?,8?,9?,10?,11-,12-,13+,14+,15+/m1/s1/i16T |
| InChIKey | SJGAQJDOXWHZTL-RLPXVNCASA-N |
| XLogP | -0.27 |
| TPSA | 179.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.28 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|