C16H28Ac2BN4O7S — CID 59036293
CID 59036293 (PubChem CID 59036293) has the molecular formula C16H28Ac2BN4O7S and a molecular weight of 887.31 g/mol.
| Compound Name | CID 59036293 |
|---|---|
| PubChem CID | 59036293 |
| Molecular Formula | C16H28Ac2BN4O7S |
| Molecular Weight | 887.31 g/mol |
| Exact Mass | 887.24 |
| IUPAC Name | — |
| SMILES | [Ac].[Ac].[H]/N=C(\C)O[C@@H]1OC(C)[C@H](O[C@@H]2OC(CC)[C@H](OS[B][3H])[C@H](O)C2N=[N+]=[N-])[C@@H](C)C1O |
| InChI | InChI=1S/C16H28BN4O7S.2Ac/c1-5-9-14(28-29-17)12(23)10(20-21-19)15(26-9)27-13-6(2)11(22)16(24-7(13)3)25-8(4)18;;/h6-7,9-18,22-23H,5H2,1-4H3;;/b18-8+;;/t6-,7?,9?,10?,11?,12+,13+,14-,15-,16-;;/m0../s1/i17T;; |
| InChIKey | FQZVWDOSYXAQQH-ODBDGBJMSA-N |
| XLogP | 1.15 |
| TPSA | 159.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|