C13H24O4 — CID 59036477
ethyl (2R,3R,4S,5S)-6-[[deuterio(tritio)methoxy]methyl]-3,4,5-trimethyloxane-2-carboxylate (PubChem CID 59036477) has the molecular formula C13H24O4 and a molecular weight of 247.35 g/mol. Its IUPAC name is ethyl (2R,3R,4S,5S)-6-[[deuterio(tritio)methoxy]methyl]-3,4,5-trimethyloxane-2-carboxylate.
| Compound Name | ethyl (2R,3R,4S,5S)-6-[[deuterio(tritio)methoxy]methyl]-3,4,5-trimethyloxane-2-carboxylate |
|---|---|
| PubChem CID | 59036477 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | ethyl (2R,3R,4S,5S)-6-[[deuterio(tritio)methoxy]methyl]-3,4,5-trimethyloxane-2-carboxylate |
| SMILES | [2H]C([3H])OCC1O[C@@H](C(=O)OCC)[C@H](C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C13H24O4/c1-6-16-13(14)12-10(4)8(2)9(3)11(17-12)7-15-5/h8-12H,6-7H2,1-5H3/t8-,9-,10+,11?,12+/m0/s1/i5TD/t5?,8-,9-,10+,11?,12+ |
| InChIKey | FQGRSXOSRZXJHY-JLBYATJJSA-N |
| XLogP | 1.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |