C12H22O4 — CID 59036510
methyl (2S,3R,4S,5S,6S)-6-[[deuterio(tritio)methoxy]methyl]-3,4,5-trimethyloxane-2-carboxylate (PubChem CID 59036510) has the molecular formula C12H22O4 and a molecular weight of 233.32 g/mol. Its IUPAC name is methyl (2S,3R,4S,5S,6S)-6-[[deuterio(tritio)methoxy]methyl]-3,4,5-trimethyloxane-2-carboxylate.
| Compound Name | methyl (2S,3R,4S,5S,6S)-6-[[deuterio(tritio)methoxy]methyl]-3,4,5-trimethyloxane-2-carboxylate |
|---|---|
| PubChem CID | 59036510 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.17 |
| IUPAC Name | methyl (2S,3R,4S,5S,6S)-6-[[deuterio(tritio)methoxy]methyl]-3,4,5-trimethyloxane-2-carboxylate |
| SMILES | [2H]C([3H])OC[C@H]1O[C@H](C(=O)OC)[C@H](C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C12H22O4/c1-7-8(2)10(6-14-4)16-11(9(7)3)12(13)15-5/h7-11H,6H2,1-5H3/t7-,8-,9+,10+,11-/m0/s1/i4TD/t4?,7-,8-,9+,10+,11- |
| InChIKey | IPZHSPSLEWKTGY-OKTLXSBFSA-N |
| XLogP | 1.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |