C11H23O3SiU- — CID 59038886
2-[[dimethyl(propan-2-yl)silyl]oxymethyl]-4-methyl-2,3,4,5-tetrahydrofuran-5-id-3-ol;uranium (PubChem CID 59038886) has the molecular formula C11H23O3SiU- and a molecular weight of 469.42 g/mol. Its IUPAC name is 2-[[dimethyl(propan-2-yl)silyl]oxymethyl]-4-methyl-2,3,4,5-tetrahydrofuran-5-id-3-ol;uranium.
| Compound Name | 2-[[dimethyl(propan-2-yl)silyl]oxymethyl]-4-methyl-2,3,4,5-tetrahydrofuran-5-id-3-ol;uranium |
|---|---|
| PubChem CID | 59038886 |
| Molecular Formula | C11H23O3SiU- |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 2-[[dimethyl(propan-2-yl)silyl]oxymethyl]-4-methyl-2,3,4,5-tetrahydrofuran-5-id-3-ol;uranium |
| SMILES | CC1[CH-]OC(CO[Si](C)(C)C(C)C)C1O.[U] |
| InChI | InChI=1S/C11H23O3Si.U/c1-8(2)15(4,5)14-7-10-11(12)9(3)6-13-10;/h6,8-12H,7H2,1-5H3;/q-1; |
| InChIKey | AMOKDEVLTWFUIY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|