C13H25O4SiU- — CID 59038906
[5-[[dimethyl(propan-2-yl)silyl]oxymethyl]-4-methyl-2,3,4,5-tetrahydrofuran-2-id-3-yl] acetate;uranium (PubChem CID 59038906) has the molecular formula C13H25O4SiU- and a molecular weight of 511.45 g/mol. Its IUPAC name is [5-[[dimethyl(propan-2-yl)silyl]oxymethyl]-4-methyl-2,3,4,5-tetrahydrofuran-2-id-3-yl] acetate;uranium.
| Compound Name | [5-[[dimethyl(propan-2-yl)silyl]oxymethyl]-4-methyl-2,3,4,5-tetrahydrofuran-2-id-3-yl] acetate;uranium |
|---|---|
| PubChem CID | 59038906 |
| Molecular Formula | C13H25O4SiU- |
| Molecular Weight | 511.45 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | [5-[[dimethyl(propan-2-yl)silyl]oxymethyl]-4-methyl-2,3,4,5-tetrahydrofuran-2-id-3-yl] acetate;uranium |
| SMILES | CC(=O)OC1[CH-]OC(CO[Si](C)(C)C(C)C)C1C.[U] |
| InChI | InChI=1S/C13H25O4Si.U/c1-9(2)18(5,6)16-8-12-10(3)13(7-15-12)17-11(4)14;/h7,9-10,12-13H,8H2,1-6H3;/q-1; |
| InChIKey | DLEJSIYGZYSQDB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|