C21H29FO4 — CID 59048733
(2S)-1-(4-fluorophenoxy)-5-methyl-9-(oxan-2-yloxy)non-6-yn-2-ol (PubChem CID 59048733) has the molecular formula C21H29FO4 and a molecular weight of 364.46 g/mol. Its IUPAC name is (2S)-1-(4-fluorophenoxy)-5-methyl-9-(oxan-2-yloxy)non-6-yn-2-ol.
| Compound Name | (2S)-1-(4-fluorophenoxy)-5-methyl-9-(oxan-2-yloxy)non-6-yn-2-ol |
|---|---|
| PubChem CID | 59048733 |
| Molecular Formula | C21H29FO4 |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | (2S)-1-(4-fluorophenoxy)-5-methyl-9-(oxan-2-yloxy)non-6-yn-2-ol |
| SMILES | CC(C#CCCOC1CCCCO1)CC[C@H](O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C21H29FO4/c1-17(6-2-4-14-24-21-7-3-5-15-25-21)8-11-19(23)16-26-20-12-9-18(22)10-13-20/h9-10,12-13,17,19,21,23H,3-5,7-8,11,14-16H2,1H3/t17?,19-,21?/m0/s1 |
| InChIKey | GJAZQLQZDSCPHZ-BIXGBWIQSA-N |
| XLogP | 3.92 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|