C14H20N2O4S2 — CID 59050251
(3R)-N-hydroxy-3-methyl-4-(4-methylphenyl)sulfonyl-1,4-thiazepane-3-carboxamide (PubChem CID 59050251) has the molecular formula C14H20N2O4S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is (3R)-N-hydroxy-3-methyl-4-(4-methylphenyl)sulfonyl-1,4-thiazepane-3-carboxamide.
| Compound Name | (3R)-N-hydroxy-3-methyl-4-(4-methylphenyl)sulfonyl-1,4-thiazepane-3-carboxamide |
|---|---|
| PubChem CID | 59050251 |
| Molecular Formula | C14H20N2O4S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | (3R)-N-hydroxy-3-methyl-4-(4-methylphenyl)sulfonyl-1,4-thiazepane-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCSC[C@@]2(C)C(=O)NO)cc1 |
| InChI | InChI=1S/C14H20N2O4S2/c1-11-4-6-12(7-5-11)22(19,20)16-8-3-9-21-10-14(16,2)13(17)15-18/h4-7,18H,3,8-10H2,1-2H3,(H,15,17)/t14-/m0/s1 |
| InChIKey | ONRZRHGAHABAFG-AWEZNQCLSA-N |
| XLogP | 1.39 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|