C26H30O2 — CID 59052837
(2,3,4,5-tetraethyl-5-phenylcyclopenta-1,3-dien-1-yl) benzoate (PubChem CID 59052837) has the molecular formula C26H30O2 and a molecular weight of 374.52 g/mol. Its IUPAC name is (2,3,4,5-tetraethyl-5-phenylcyclopenta-1,3-dien-1-yl) benzoate.
| Compound Name | (2,3,4,5-tetraethyl-5-phenylcyclopenta-1,3-dien-1-yl) benzoate |
|---|---|
| PubChem CID | 59052837 |
| Molecular Formula | C26H30O2 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | (2,3,4,5-tetraethyl-5-phenylcyclopenta-1,3-dien-1-yl) benzoate |
| SMILES | CCC1=C(CC)C(CC)(c2ccccc2)C(OC(=O)c2ccccc2)=C1CC |
| InChI | InChI=1S/C26H30O2/c1-5-21-22(6-2)24(28-25(27)19-15-11-9-12-16-19)26(8-4,23(21)7-3)20-17-13-10-14-18-20/h9-18H,5-8H2,1-4H3 |
| InChIKey | FWHCDEAAEATFLX-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |