About (4-benzoyloxy-4,6-diethyl-3-methylcyclohexa-1,5-dien-1-yl) benzoate
(4-benzoyloxy-4,6-diethyl-3-methylcyclohexa-1,5-dien-1-yl) benzoate (PubChem CID 151283666) has the molecular formula C25H26O4
and a molecular weight of 390.48 g/mol. Its IUPAC name is (4-benzoyloxy-4,6-diethyl-3-methylcyclohexa-1,5-dien-1-yl) benzoate.
Molecular Properties
| Compound Name | (4-benzoyloxy-4,6-diethyl-3-methylcyclohexa-1,5-dien-1-yl) benzoate |
| PubChem CID | 151283666 |
| Molecular Formula | C25H26O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | (4-benzoyloxy-4,6-diethyl-3-methylcyclohexa-1,5-dien-1-yl) benzoate |
| SMILES | CCC1=CC(CC)(OC(=O)c2ccccc2)C(C)C=C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H26O4/c1-4-19-17-25(5-2,29-24(27)21-14-10-7-11-15-21)18(3)16-22(19)28-23(26)20-12-8-6-9-13-20/h6-18H,4-5H2,1-3H3 |
| InChIKey | NYXVLSYYXPBELO-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-benzoyloxy-4,6-diethyl-3-methylcyclohexa-1,5-dien-1-yl) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-benzoyloxy-4,6-diethyl-3-methylcyclohexa-1,5-dien-1-yl) benzoate?
The IUPAC name of (4-benzoyloxy-4,6-diethyl-3-methylcyclohexa-1,5-dien-1-yl) benzoate (CID 151283666) is (4-benzoyloxy-4,6-diethyl-3-methylcyclohexa-1,5-dien-1-yl) benzoate.
What is the SMILES notation for (4-benzoyloxy-4,6-diethyl-3-methylcyclohexa-1,5-dien-1-yl) benzoate?
The canonical SMILES for (4-benzoyloxy-4,6-diethyl-3-methylcyclohexa-1,5-dien-1-yl) benzoate is CCC1=CC(CC)(OC(=O)c2ccccc2)C(C)C=C1OC(=O)c1ccccc1.
What is the InChIKey of (4-benzoyloxy-4,6-diethyl-3-methylcyclohexa-1,5-dien-1-yl) benzoate?
The InChIKey is NYXVLSYYXPBELO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26O4/c1-4-19-17-25(5-2,29-24(27)21-14-10-7-11-15-21)18(3)16-22(19)28-23(26)20-12-8-6-9-13-20/h6-18H,4-5H2,1-3H3.
What are the key properties of (4-benzoyloxy-4,6-diethyl-3-methylcyclohexa-1,5-dien-1-yl) benzoate?
(4-benzoyloxy-4,6-diethyl-3-methylcyclohexa-1,5-dien-1-yl) benzoate has a molecular weight of 390.48 g/mol, XLogP of 5.72, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-benzoyloxy-4,6-diethyl-3-methylcyclohexa-1,5-dien-1-yl) benzoate is sourced from PubChem (CID 151283666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).