C21H33N5O4S2 — CID 59052887
1-[(1S,2S)-2-(dimethylamino)cyclohexyl]-3-[(1S,2S)-2-[(4-nitrophenyl)sulfonylamino]cyclohexyl]thiourea (PubChem CID 59052887) has the molecular formula C21H33N5O4S2 and a molecular weight of 483.66 g/mol. Its IUPAC name is 1-[(1S,2S)-2-(dimethylamino)cyclohexyl]-3-[(1S,2S)-2-[(4-nitrophenyl)sulfonylamino]cyclohexyl]thiourea.
| Compound Name | 1-[(1S,2S)-2-(dimethylamino)cyclohexyl]-3-[(1S,2S)-2-[(4-nitrophenyl)sulfonylamino]cyclohexyl]thiourea |
|---|---|
| PubChem CID | 59052887 |
| Molecular Formula | C21H33N5O4S2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 1-[(1S,2S)-2-(dimethylamino)cyclohexyl]-3-[(1S,2S)-2-[(4-nitrophenyl)sulfonylamino]cyclohexyl]thiourea |
| SMILES | CN(C)[C@H]1CCCC[C@@H]1NC(=S)N[C@H]1CCCC[C@@H]1NS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H33N5O4S2/c1-25(2)20-10-6-5-9-19(20)23-21(31)22-17-7-3-4-8-18(17)24-32(29,30)16-13-11-15(12-14-16)26(27)28/h11-14,17-20,24H,3-10H2,1-2H3,(H2,22,23,31)/t17-,18-,19-,20-/m0/s1 |
| InChIKey | ZFPODHLUXHDKTG-MUGJNUQGSA-N |
| XLogP | 2.52 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|