C17H20N6O3 — CID 59053920
2-(5-amino-1,3-dioxoisoindol-2-yl)-N-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)acetamide (PubChem CID 59053920) has the molecular formula C17H20N6O3 and a molecular weight of 356.39 g/mol. Its IUPAC name is 2-(5-amino-1,3-dioxoisoindol-2-yl)-N-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)acetamide.
| Compound Name | 2-(5-amino-1,3-dioxoisoindol-2-yl)-N-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)acetamide |
|---|---|
| PubChem CID | 59053920 |
| Molecular Formula | C17H20N6O3 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 2-(5-amino-1,3-dioxoisoindol-2-yl)-N-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)acetamide |
| SMILES | Nc1ccc2c(c1)C(=O)N(CC(=O)NC13CN4CN(CN(C4)C1)C3)C2=O |
| InChI | InChI=1S/C17H20N6O3/c18-11-1-2-12-13(3-11)16(26)23(15(12)25)4-14(24)19-17-5-20-8-21(6-17)10-22(7-17)9-20/h1-3H,4-10,18H2,(H,19,24) |
| InChIKey | HNOQIMMNSXOKET-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|