C12H10F3N3O3 — CID 60645311
2-(5-amino-1,3-dioxoisoindol-2-yl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 60645311) has the molecular formula C12H10F3N3O3 and a molecular weight of 301.22 g/mol. Its IUPAC name is 2-(5-amino-1,3-dioxoisoindol-2-yl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(5-amino-1,3-dioxoisoindol-2-yl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 60645311 |
| Molecular Formula | C12H10F3N3O3 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2-(5-amino-1,3-dioxoisoindol-2-yl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | Nc1ccc2c(c1)C(=O)N(CC(=O)NCC(F)(F)F)C2=O |
| InChI | InChI=1S/C12H10F3N3O3/c13-12(14,15)5-17-9(19)4-18-10(20)7-2-1-6(16)3-8(7)11(18)21/h1-3H,4-5,16H2,(H,17,19) |
| InChIKey | KRDZQEBQPQBVFR-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|