C19H12F2NO4S- — CID 59060335
2-[(2,4-difluorobenzoyl)amino]-5-(thiophen-2-ylmethoxy)benzoate (PubChem CID 59060335) has the molecular formula C19H12F2NO4S- and a molecular weight of 388.37 g/mol. Its IUPAC name is 2-[(2,4-difluorobenzoyl)amino]-5-(thiophen-2-ylmethoxy)benzoate.
| Compound Name | 2-[(2,4-difluorobenzoyl)amino]-5-(thiophen-2-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 59060335 |
| Molecular Formula | C19H12F2NO4S- |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 2-[(2,4-difluorobenzoyl)amino]-5-(thiophen-2-ylmethoxy)benzoate |
| SMILES | O=C(Nc1ccc(OCc2cccs2)cc1C(=O)[O-])c1ccc(F)cc1F |
| InChI | InChI=1S/C19H13F2NO4S/c20-11-3-5-14(16(21)8-11)18(23)22-17-6-4-12(9-15(17)19(24)25)26-10-13-2-1-7-27-13/h1-9H,10H2,(H,22,23)(H,24,25)/p-1 |
| InChIKey | IVHZGZCFPAVDRE-UHFFFAOYSA-M |
| XLogP | 3.22 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |